C30H35N4O6+ — CID 57001317
(2R)-1-[5-[3-(4-hydroxyphenyl)propyl]-1H-imidazole-2-carbonyl]-2-methyl-N-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-1-carboxamide (PubChem CID 57001317) has the molecular formula C30H35N4O6+ and a molecular weight of 547.63 g/mol. Its IUPAC name is (2R)-1-[5-[3-(4-hydroxyphenyl)propyl]-1H-imidazole-2-carbonyl]-2-methyl-N-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[5-[3-(4-hydroxyphenyl)propyl]-1H-imidazole-2-carbonyl]-2-methyl-N-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 57001317 |
| Molecular Formula | C30H35N4O6+ |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | (2R)-1-[5-[3-(4-hydroxyphenyl)propyl]-1H-imidazole-2-carbonyl]-2-methyl-N-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NC1CC(=O)OC1OCc1ccccc1)C(=O)c1ncc(CCCc2ccc(O)cc2)[nH]1 |
| InChI | InChI=1S/C30H34N4O6/c1-20-7-6-16-34(20,28(37)27-31-18-23(32-27)11-5-10-21-12-14-24(35)15-13-21)30(38)33-25-17-26(36)40-29(25)39-19-22-8-3-2-4-9-22/h2-4,8-9,12-15,18,20,25,29H,5-7,10-11,16-17,19H2,1H3,(H2-,31,32,33,35,37,38)/p+1/t20-,25?,29?,34?/m1/s1 |
| InChIKey | ONPPQXRLOHHOHZ-LONZECCISA-O |
| XLogP | 4.00 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|