C25H26N3O5+ — CID 54463234
(2S)-1-(1H-indole-2-carbonyl)-1-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-2-carboxamide (PubChem CID 54463234) has the molecular formula C25H26N3O5+ and a molecular weight of 448.50 g/mol. Its IUPAC name is (2S)-1-(1H-indole-2-carbonyl)-1-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S)-1-(1H-indole-2-carbonyl)-1-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 54463234 |
| Molecular Formula | C25H26N3O5+ |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (2S)-1-(1H-indole-2-carbonyl)-1-(5-oxo-2-phenylmethoxyoxolan-3-yl)pyrrolidin-1-ium-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[N+]1(C(=O)c1cc2ccccc2[nH]1)C1CC(=O)OC1OCc1ccccc1 |
| InChI | InChI=1S/C25H25N3O5/c26-23(30)20-11-6-12-28(20,24(31)19-13-17-9-4-5-10-18(17)27-19)21-14-22(29)33-25(21)32-15-16-7-2-1-3-8-16/h1-5,7-10,13,20-21,25H,6,11-12,14-15H2,(H2-,26,27,30,31)/p+1/t20-,21?,25?,28?/m0/s1 |
| InChIKey | PUZYCCVLJJOFEE-PZBLEYEESA-O |
| XLogP | 2.63 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|