C29H30ClNO3P+ — CID 57002191
[4-[[7-(4-chlorophenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-oxo-pentylphosphanium (PubChem CID 57002191) has the molecular formula C29H30ClNO3P+ and a molecular weight of 506.99 g/mol. Its IUPAC name is [4-[[7-(4-chlorophenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-oxo-pentylphosphanium.
| Compound Name | [4-[[7-(4-chlorophenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-oxo-pentylphosphanium |
|---|---|
| PubChem CID | 57002191 |
| Molecular Formula | C29H30ClNO3P+ |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | [4-[[7-(4-chlorophenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-oxo-pentylphosphanium |
| SMILES | CCCCC[P+](=O)Cc1ccc(NC(=O)C2=Cc3cc(-c4ccc(Cl)cc4)ccc3OCC2)cc1 |
| InChI | InChI=1S/C29H29ClNO3P/c1-2-3-4-17-35(33)20-21-5-12-27(13-6-21)31-29(32)24-15-16-34-28-14-9-23(18-25(28)19-24)22-7-10-26(30)11-8-22/h5-14,18-19H,2-4,15-17,20H2,1H3/p+1 |
| InChIKey | YOTWFHKPCPWFPJ-UHFFFAOYSA-O |
| XLogP | 8.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|