About methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate
methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 57004507) has the molecular formula C11H10ClNO3
and a molecular weight of 239.66 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate.
Analyze methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate (CID 57004507) is methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate is COC(=O)C1C=C(c2ccc(Cl)cc2)NO1.
What is the InChIKey of methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is OAPOMBPUGFQMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO3/c1-15-11(14)10-6-9(13-16-10)7-2-4-8(12)5-3-7/h2-6,10,13H,1H3.
What are the key properties of methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate?
methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 239.66 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-chlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 57004507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).