C11H12ClNO3 — CID 57126545
2-[1-(4-chlorophenyl)ethenylamino]oxypropanoic acid (PubChem CID 57126545) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)ethenylamino]oxypropanoic acid.
| Compound Name | 2-[1-(4-chlorophenyl)ethenylamino]oxypropanoic acid |
|---|---|
| PubChem CID | 57126545 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)ethenylamino]oxypropanoic acid |
| SMILES | C=C(NOC(C)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClNO3/c1-7(13-16-8(2)11(14)15)9-3-5-10(12)6-4-9/h3-6,8,13H,1H2,2H3,(H,14,15) |
| InChIKey | UVEUMDMDEDQQBI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|