3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid

C10H7Cl2NO3 — CID 57022269

IUPAC3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1C=C(c2cccc(Cl)c2Cl)NO1
InChIInChI=1S/C10H7Cl2NO3/c11-6-3-1-2-5(9(6)12)7-4-8(10(14)15)16-13-7/h1-4,8,13H,(H,14,15)
InChIKeyOLZSUOYLTIFUPA-UHFFFAOYSA-N
MW260.08 g/mol
LogP2.32
Rot. Bonds2

About 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid

3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (PubChem CID 57022269) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid
PubChem CID57022269
Molecular FormulaC10H7Cl2NO3
Molecular Weight260.08 g/mol
Exact Mass258.98
IUPAC Name3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)C1C=C(c2cccc(Cl)c2Cl)NO1
InChIInChI=1S/C10H7Cl2NO3/c11-6-3-1-2-5(9(6)12)7-4-8(10(14)15)16-13-7/h1-4,8,13H,(H,14,15)
InChIKeyOLZSUOYLTIFUPA-UHFFFAOYSA-N
XLogP2.32
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.08
LogP ≤ 52.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (CID 57022269) is 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid is O=C(O)C1C=C(c2cccc(Cl)c2Cl)NO1.
What is the InChIKey of 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
The InChIKey is OLZSUOYLTIFUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO3/c11-6-3-1-2-5(9(6)12)7-4-8(10(14)15)16-13-7/h1-4,8,13H,(H,14,15).
What are the key properties of 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid?
3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid has a molecular weight of 260.08 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dichlorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 57022269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).