4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid

C11H11Cl2NO3 — CID 90686350

IUPAC4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid
SMILESCONC(=CCC(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO3/c1-17-14-10(4-5-11(15)16)7-2-3-8(12)9(13)6-7/h2-4,6,14H,5H2,1H3,(H,15,16)
InChIKeyKVALJUHKFDPUAF-UHFFFAOYSA-N
MW276.12 g/mol
LogP2.96
Rot. Bonds5

About 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid

4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid (PubChem CID 90686350) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid.

Molecular Properties

Compound Name4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid
PubChem CID90686350
Molecular FormulaC11H11Cl2NO3
Molecular Weight276.12 g/mol
Exact Mass275.01
IUPAC Name4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid
SMILESCONC(=CCC(=O)O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H11Cl2NO3/c1-17-14-10(4-5-11(15)16)7-2-3-8(12)9(13)6-7/h2-4,6,14H,5H2,1H3,(H,15,16)
InChIKeyKVALJUHKFDPUAF-UHFFFAOYSA-N
XLogP2.96
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.12
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid?
The IUPAC name of 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid (CID 90686350) is 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid?
The canonical SMILES for 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid is CONC(=CCC(=O)O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid?
The InChIKey is KVALJUHKFDPUAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO3/c1-17-14-10(4-5-11(15)16)7-2-3-8(12)9(13)6-7/h2-4,6,14H,5H2,1H3,(H,15,16).
What are the key properties of 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid?
4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid has a molecular weight of 276.12 g/mol, XLogP of 2.96, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid is sourced from PubChem (CID 90686350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).