C11H11Cl2NO3 — CID 90686350
4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid (PubChem CID 90686350) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid.
| Compound Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid |
|---|---|
| PubChem CID | 90686350 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enoic acid |
| SMILES | CONC(=CCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO3/c1-17-14-10(4-5-11(15)16)7-2-3-8(12)9(13)6-7/h2-4,6,14H,5H2,1H3,(H,15,16) |
| InChIKey | KVALJUHKFDPUAF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|