C11H10Cl2N2O — CID 90694101
4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enenitrile (PubChem CID 90694101) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enenitrile.
| Compound Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enenitrile |
|---|---|
| PubChem CID | 90694101 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-(methoxyamino)but-3-enenitrile |
| SMILES | CONC(=CCC#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N2O/c1-16-15-11(3-2-6-14)8-4-5-9(12)10(13)7-8/h3-5,7,15H,2H2,1H3 |
| InChIKey | WXXRSTUMOZBNJS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|