C9H9Cl2NO — CID 57063680
1-(3,4-dichlorophenyl)-N-methoxyethenamine (PubChem CID 57063680) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methoxyethenamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methoxyethenamine |
|---|---|
| PubChem CID | 57063680 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methoxyethenamine |
| SMILES | C=C(NOC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NO/c1-6(12-13-2)7-3-4-8(10)9(11)5-7/h3-5,12H,1H2,2H3 |
| InChIKey | KPTYGLATXWZMJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|