C27H34N2O4 — CID 57004878
tert-butyl (2R,4R,5S)-1-benzyl-5-ethenyl-4-[methyl(phenylmethoxycarbonyl)amino]pyrrolidine-2-carboxylate (PubChem CID 57004878) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl (2R,4R,5S)-1-benzyl-5-ethenyl-4-[methyl(phenylmethoxycarbonyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4R,5S)-1-benzyl-5-ethenyl-4-[methyl(phenylmethoxycarbonyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57004878 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl (2R,4R,5S)-1-benzyl-5-ethenyl-4-[methyl(phenylmethoxycarbonyl)amino]pyrrolidine-2-carboxylate |
| SMILES | C=C[C@H]1[C@H](N(C)C(=O)OCc2ccccc2)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4/c1-6-22-23(28(5)26(31)32-19-21-15-11-8-12-16-21)17-24(25(30)33-27(2,3)4)29(22)18-20-13-9-7-10-14-20/h6-16,22-24H,1,17-19H2,2-5H3/t22-,23+,24+/m0/s1 |
| InChIKey | GDTIWBOGAQCOKR-RBZQAINGSA-N |
| XLogP | 4.79 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|