About methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate
methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate (PubChem CID 57005806) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate.
Molecular Properties
| Compound Name | methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate |
| PubChem CID | 57005806 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate |
| SMILES | COC(=O)C(C)=C(C)CCC(CO)(CO)CO |
| InChI | InChI=1S/C12H22O5/c1-9(10(2)11(16)17-3)4-5-12(6-13,7-14)8-15/h13-15H,4-8H2,1-3H3 |
| InChIKey | NXWZAAVRKWFMIH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate?
The IUPAC name of methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate (CID 57005806) is methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate.
What is the SMILES notation for methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate?
The canonical SMILES for methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate is COC(=O)C(C)=C(C)CCC(CO)(CO)CO.
What is the InChIKey of methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate?
The InChIKey is NXWZAAVRKWFMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O5/c1-9(10(2)11(16)17-3)4-5-12(6-13,7-14)8-15/h13-15H,4-8H2,1-3H3.
What are the key properties of methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate?
methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate has a molecular weight of 246.30 g/mol, XLogP of 0.24, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-hydroxy-6,6-bis(hydroxymethyl)-2,3-dimethylhept-2-enoate is sourced from PubChem (CID 57005806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).