C23H28N2O2 — CID 57005985
ethyl (2S)-5-(1H-indol-3-yl)-2-(1-phenylethylamino)pentanoate (PubChem CID 57005985) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl (2S)-5-(1H-indol-3-yl)-2-(1-phenylethylamino)pentanoate.
| Compound Name | ethyl (2S)-5-(1H-indol-3-yl)-2-(1-phenylethylamino)pentanoate |
|---|---|
| PubChem CID | 57005985 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl (2S)-5-(1H-indol-3-yl)-2-(1-phenylethylamino)pentanoate |
| SMILES | CCOC(=O)[C@H](CCCc1c[nH]c2ccccc12)NC(C)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-27-23(26)22(25-17(2)18-10-5-4-6-11-18)15-9-12-19-16-24-21-14-8-7-13-20(19)21/h4-8,10-11,13-14,16-17,22,24-25H,3,9,12,15H2,1-2H3/t17?,22-/m0/s1 |
| InChIKey | ROSXZDSNAXEZLW-UGNFMNBCSA-N |
| XLogP | 4.77 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |