C9H11NO6S2 — CID 57006005
4-(1-amino-1-oxopropan-2-yl)oxysulfinylbenzenesulfonic acid (PubChem CID 57006005) has the molecular formula C9H11NO6S2 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-(1-amino-1-oxopropan-2-yl)oxysulfinylbenzenesulfonic acid.
| Compound Name | 4-(1-amino-1-oxopropan-2-yl)oxysulfinylbenzenesulfonic acid |
|---|---|
| PubChem CID | 57006005 |
| Molecular Formula | C9H11NO6S2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-(1-amino-1-oxopropan-2-yl)oxysulfinylbenzenesulfonic acid |
| SMILES | CC(OS(=O)c1ccc(S(=O)(=O)O)cc1)C(N)=O |
| InChI | InChI=1S/C9H11NO6S2/c1-6(9(10)11)16-17(12)7-2-4-8(5-3-7)18(13,14)15/h2-6H,1H3,(H2,10,11)(H,13,14,15) |
| InChIKey | YMGLBZNGLYLTDK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|