About 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one
6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 57006155) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| PubChem CID | 57006155 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | COc1ccc(N2Cc3cnc(N)cc3C2=O)cc1OC |
| InChI | InChI=1S/C15H15N3O3/c1-20-12-4-3-10(5-13(12)21-2)18-8-9-7-17-14(16)6-11(9)15(18)19/h3-7H,8H2,1-2H3,(H2,16,17) |
| InChIKey | ZCMHCJQNMKXJSE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The IUPAC name of 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (CID 57006155) is 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
What is the SMILES notation for 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The canonical SMILES for 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one is COc1ccc(N2Cc3cnc(N)cc3C2=O)cc1OC.
What is the InChIKey of 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The InChIKey is ZCMHCJQNMKXJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3/c1-20-12-4-3-10(5-13(12)21-2)18-8-9-7-17-14(16)6-11(9)15(18)19/h3-7H,8H2,1-2H3,(H2,16,17).
What are the key properties of 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one has a molecular weight of 285.30 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(3,4-dimethoxyphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one is sourced from PubChem (CID 57006155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).