C11H17N2O4+ — CID 57008964
1-(2,5-dihydroxypyrrol-1-yl)-1-methylpiperidin-1-ium-3-carboxylic acid (PubChem CID 57008964) has the molecular formula C11H17N2O4+ and a molecular weight of 241.27 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)-1-methylpiperidin-1-ium-3-carboxylic acid.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)-1-methylpiperidin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 57008964 |
| Molecular Formula | C11H17N2O4+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)-1-methylpiperidin-1-ium-3-carboxylic acid |
| SMILES | C[N+]1(n2c(O)ccc2O)CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H16N2O4/c1-13(12-9(14)4-5-10(12)15)6-2-3-8(7-13)11(16)17/h4-5,8H,2-3,6-7H2,1H3,(H2-,14,15,16,17)/p+1 |
| InChIKey | UEWGRNBDGZDKLZ-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|