C10H14BrNO4 — CID 54073359
2-(bromomethyl)-5-(2,5-dihydroxypyrrol-1-yl)pentanoic acid (PubChem CID 54073359) has the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(2,5-dihydroxypyrrol-1-yl)pentanoic acid.
| Compound Name | 2-(bromomethyl)-5-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 54073359 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-(bromomethyl)-5-(2,5-dihydroxypyrrol-1-yl)pentanoic acid |
| SMILES | O=C(O)C(CBr)CCCn1c(O)ccc1O |
| InChI | InChI=1S/C10H14BrNO4/c11-6-7(10(15)16)2-1-5-12-8(13)3-4-9(12)14/h3-4,7,13-14H,1-2,5-6H2,(H,15,16) |
| InChIKey | MHZYAMMWSXIFEM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|