C25H24N2O2 — CID 57009017
N-[(1S)-1-[(5S)-3-benzyl-2,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]benzamide (PubChem CID 57009017) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(1S)-1-[(5S)-3-benzyl-2,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]benzamide.
| Compound Name | N-[(1S)-1-[(5S)-3-benzyl-2,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 57009017 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[(1S)-1-[(5S)-3-benzyl-2,5-dihydro-1,2-oxazol-5-yl]-2-phenylethyl]benzamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H]1C=C(Cc2ccccc2)NO1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c28-25(21-14-8-3-9-15-21)26-23(17-20-12-6-2-7-13-20)24-18-22(27-29-24)16-19-10-4-1-5-11-19/h1-15,18,23-24,27H,16-17H2,(H,26,28)/t23-,24-/m0/s1 |
| InChIKey | WOZSHGNHRSQLIQ-ZEQRLZLVSA-N |
| XLogP | 4.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |