C25H32Cl2N2O — CID 57009579
2,2-bis(4-chlorophenyl)-N-(4-methyl-2-pyrrolidin-1-ylpentyl)propanamide (PubChem CID 57009579) has the molecular formula C25H32Cl2N2O and a molecular weight of 447.45 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N-(4-methyl-2-pyrrolidin-1-ylpentyl)propanamide.
| Compound Name | 2,2-bis(4-chlorophenyl)-N-(4-methyl-2-pyrrolidin-1-ylpentyl)propanamide |
|---|---|
| PubChem CID | 57009579 |
| Molecular Formula | C25H32Cl2N2O |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N-(4-methyl-2-pyrrolidin-1-ylpentyl)propanamide |
| SMILES | CC(C)CC(CNC(=O)C(C)(c1ccc(Cl)cc1)c1ccc(Cl)cc1)N1CCCC1 |
| InChI | InChI=1S/C25H32Cl2N2O/c1-18(2)16-23(29-14-4-5-15-29)17-28-24(30)25(3,19-6-10-21(26)11-7-19)20-8-12-22(27)13-9-20/h6-13,18,23H,4-5,14-17H2,1-3H3,(H,28,30) |
| InChIKey | RMXXZJRHYXGEEP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |