C20H31ClN2O2 — CID 55871235
2-(4-chlorophenyl)-2-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide (PubChem CID 55871235) has the molecular formula C20H31ClN2O2 and a molecular weight of 366.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide |
|---|---|
| PubChem CID | 55871235 |
| Molecular Formula | C20H31ClN2O2 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide |
| SMILES | CC(C)CC(CNC(=O)C(C)(C)c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H31ClN2O2/c1-15(2)13-18(23-9-11-25-12-10-23)14-22-19(24)20(3,4)16-5-7-17(21)8-6-16/h5-8,15,18H,9-14H2,1-4H3,(H,22,24) |
| InChIKey | SGMCLVOSQQOYAR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |