C15H25FO — CID 57009832
5-butyl-2-(4-fluorocyclohex-3-en-1-yl)oxane (PubChem CID 57009832) has the molecular formula C15H25FO and a molecular weight of 240.36 g/mol. Its IUPAC name is 5-butyl-2-(4-fluorocyclohex-3-en-1-yl)oxane.
| Compound Name | 5-butyl-2-(4-fluorocyclohex-3-en-1-yl)oxane |
|---|---|
| PubChem CID | 57009832 |
| Molecular Formula | C15H25FO |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 5-butyl-2-(4-fluorocyclohex-3-en-1-yl)oxane |
| SMILES | CCCCC1CCC(C2CC=C(F)CC2)OC1 |
| InChI | InChI=1S/C15H25FO/c1-2-3-4-12-5-10-15(17-11-12)13-6-8-14(16)9-7-13/h8,12-13,15H,2-7,9-11H2,1H3 |
| InChIKey | NCOUYYWDBJVHRC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |