C7H10N4O2 — CID 57010106
(2R)-2-amino-2-(2-aminopyrimidin-4-yl)propanoic acid (PubChem CID 57010106) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is (2R)-2-amino-2-(2-aminopyrimidin-4-yl)propanoic acid.
| Compound Name | (2R)-2-amino-2-(2-aminopyrimidin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 57010106 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (2R)-2-amino-2-(2-aminopyrimidin-4-yl)propanoic acid |
| SMILES | C[C@](N)(C(=O)O)c1ccnc(N)n1 |
| InChI | InChI=1S/C7H10N4O2/c1-7(9,5(12)13)4-2-3-10-6(8)11-4/h2-3H,9H2,1H3,(H,12,13)(H2,8,10,11)/t7-/m1/s1 |
| InChIKey | RQNGINTWLVEQIM-SSDOTTSWSA-N |
| XLogP | -0.68 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |