C7H12O7 — CID 57010245
(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-4-carboxylic acid (PubChem CID 57010245) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-4-carboxylic acid.
| Compound Name | (2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-4-carboxylic acid |
|---|---|
| PubChem CID | 57010245 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methyloxane-4-carboxylic acid |
| SMILES | C[C@H]1O[C@@H](O)[C@H](O)[C@](O)(C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C7H12O7/c1-2-3(8)7(13,6(11)12)4(9)5(10)14-2/h2-5,8-10,13H,1H3,(H,11,12)/t2-,3-,4+,5-,7+/m1/s1 |
| InChIKey | YKNKKMJMWPIYNA-IQKRMLQVSA-N |
| XLogP | -2.74 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |