C12H21ClO11 — CID 57010952
(2S,3S,4S,5S,6S)-6-[chloro(hydroxy)methyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol (PubChem CID 57010952) has the molecular formula C12H21ClO11 and a molecular weight of 376.74 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-[chloro(hydroxy)methyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6S)-6-[chloro(hydroxy)methyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57010952 |
| Molecular Formula | C12H21ClO11 |
| Molecular Weight | 376.74 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-[chloro(hydroxy)methyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC[C@](O)([C@]2(O)[C@@H](O)O[C@H](C(O)Cl)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21ClO11/c13-9(19)6-5(16)8(18)12(22,10(20)24-6)11(21)2-23-3(1-14)4(15)7(11)17/h3-10,14-22H,1-2H2/t3-,4-,5-,6+,7+,8+,9?,10+,11-,12-/m1/s1 |
| InChIKey | WTSMFFCBYHXOTK-RDGWTPLYSA-N |
| XLogP | -5.44 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.74 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|