C12H23NO10 — CID 57018621
(2S,3S,4S,5S,6R)-6-(aminomethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol (PubChem CID 57018621) has the molecular formula C12H23NO10 and a molecular weight of 341.31 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-6-(aminomethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S,6R)-6-(aminomethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 57018621 |
| Molecular Formula | C12H23NO10 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2S,3S,4S,5S,6R)-6-(aminomethyl)-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxane-2,3,4,5-tetrol |
| SMILES | NC[C@H]1O[C@H](O)[C@@](O)([C@@]2(O)CO[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23NO10/c13-1-4-6(15)9(18)12(21,10(19)23-4)11(20)3-22-5(2-14)7(16)8(11)17/h4-10,14-21H,1-3,13H2/t4-,5-,6-,7-,8+,9+,10+,11-,12-/m1/s1 |
| InChIKey | QIUABOPNWPEPFR-QEGQGZEBSA-N |
| XLogP | -6.04 |
| TPSA | 206.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |