C31H37N9O4 — CID 57013269
(2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoyl-[[4-[(carbamoylamino)methyl]phenyl]methyl]amino]-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanamide (PubChem CID 57013269) has the molecular formula C31H37N9O4 and a molecular weight of 599.70 g/mol. Its IUPAC name is (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoyl-[[4-[(carbamoylamino)methyl]phenyl]methyl]amino]-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanamide.
| Compound Name | (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoyl-[[4-[(carbamoylamino)methyl]phenyl]methyl]amino]-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 57013269 |
| Molecular Formula | C31H37N9O4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | (2R)-2-[(2-butyl-3H-benzimidazol-5-yl)carbamoyl-[[4-[(carbamoylamino)methyl]phenyl]methyl]amino]-3-[3-(N'-hydroxycarbamimidoyl)phenyl]propanamide |
| SMILES | CCCCc1nc2ccc(NC(=O)N(Cc3ccc(CNC(N)=O)cc3)[C@H](Cc3cccc(C(N)=NO)c3)C(N)=O)cc2[nH]1 |
| InChI | InChI=1S/C31H37N9O4/c1-2-3-7-27-37-24-13-12-23(16-25(24)38-27)36-31(43)40(18-20-10-8-19(9-11-20)17-35-30(34)42)26(29(33)41)15-21-5-4-6-22(14-21)28(32)39-44/h4-6,8-14,16,26,44H,2-3,7,15,17-18H2,1H3,(H2,32,39)(H2,33,41)(H,36,43)(H,37,38)(H3,34,35,42)/t26-/m1/s1 |
| InChIKey | OAQSQMNWOTXHIL-AREMUKBSSA-N |
| XLogP | 3.30 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|