C18H30NO6S+ — CID 57014295
tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-4-methoxy-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57014295) has the molecular formula C18H30NO6S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-4-methoxy-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-4-methoxy-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57014295 |
| Molecular Formula | C18H30NO6S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-4-methoxy-4-oxobutanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COC(=O)CC(CSC(C)=O)C(=O)[N+]1(C(=O)OC(C)(C)C)CCC[C@H]1C |
| InChI | InChI=1S/C18H30NO6S/c1-12-8-7-9-19(12,17(23)25-18(3,4)5)16(22)14(10-15(21)24-6)11-26-13(2)20/h12,14H,7-11H2,1-6H3/q+1/t12-,14?,19?/m1/s1 |
| InChIKey | XUFACRDQWVOCCG-RMQJPMRHSA-N |
| XLogP | 2.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|