C17H28NO6S+ — CID 57279475
3-(acetylsulfanylmethyl)-4-[(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-1-yl]-4-oxobutanoic acid (PubChem CID 57279475) has the molecular formula C17H28NO6S+ and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-(acetylsulfanylmethyl)-4-[(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-1-yl]-4-oxobutanoic acid.
| Compound Name | 3-(acetylsulfanylmethyl)-4-[(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57279475 |
| Molecular Formula | C17H28NO6S+ |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-(acetylsulfanylmethyl)-4-[(2R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-1-yl]-4-oxobutanoic acid |
| SMILES | CC(=O)SCC(CC(=O)O)C(=O)[N+]1(C(=O)OC(C)(C)C)CCC[C@H]1C |
| InChI | InChI=1S/C17H27NO6S/c1-11-7-6-8-18(11,16(23)24-17(3,4)5)15(22)13(9-14(20)21)10-25-12(2)19/h11,13H,6-10H2,1-5H3/p+1/t11-,13?,18?/m1/s1 |
| InChIKey | FPFHXBKCNZSNTP-YCTMXLSVSA-O |
| XLogP | 2.82 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|