C14H23NO4S — CID 105353971
2-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanyl-3-methylbutanoic acid (PubChem CID 105353971) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanyl-3-methylbutanoic acid.
| Compound Name | 2-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105353971 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)sulfanyl-3-methylbutanoic acid |
| SMILES | CCC(CC)N1C(=O)CC(SC(C(=O)O)C(C)C)C1=O |
| InChI | InChI=1S/C14H23NO4S/c1-5-9(6-2)15-11(16)7-10(13(15)17)20-12(8(3)4)14(18)19/h8-10,12H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | DNWSYJPRXHKDOV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|