C14H24NO4S+ — CID 57011992
(2R)-1-[2-(acetylsulfanylmethyl)pentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57011992) has the molecular formula C14H24NO4S+ and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-1-[2-(acetylsulfanylmethyl)pentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(acetylsulfanylmethyl)pentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57011992 |
| Molecular Formula | C14H24NO4S+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2R)-1-[2-(acetylsulfanylmethyl)pentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCC(CSC(C)=O)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C14H23NO4S/c1-4-6-12(9-20-11(3)16)13(17)15(14(18)19)8-5-7-10(15)2/h10,12H,4-9H2,1-3H3/p+1/t10-,12?,15?/m1/s1 |
| InChIKey | USHDODJZSMCFBL-CKQAKLJMSA-O |
| XLogP | 2.89 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|