C14H25N2O4S+ — CID 57052487
(2R)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57052487) has the molecular formula C14H25N2O4S+ and a molecular weight of 317.43 g/mol. Its IUPAC name is (2R)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57052487 |
| Molecular Formula | C14H25N2O4S+ |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (2R)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SCC(CCCN)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C14H24N2O4S/c1-10-5-4-8-16(10,14(19)20)13(18)12(6-3-7-15)9-21-11(2)17/h10,12H,3-9,15H2,1-2H3/p+1/t10-,12?,16?/m1/s1 |
| InChIKey | BQCFCANGTCFSIN-WCVRRQIGSA-O |
| XLogP | 1.82 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|