C16H26F3N2O4S+ — CID 57076685
(2R)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57076685) has the molecular formula C16H26F3N2O4S+ and a molecular weight of 399.46 g/mol. Its IUPAC name is (2R)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57076685 |
| Molecular Formula | C16H26F3N2O4S+ |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (2R)-1-[2-[[(2S)-2-aminohexanoyl]sulfanylmethyl]-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCC[C@H](N)C(=O)SCC(C(=O)[N+]1(C(=O)O)CCC[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O4S/c1-3-4-7-12(20)14(23)26-9-11(16(17,18)19)13(22)21(15(24)25)8-5-6-10(21)2/h10-12H,3-9,20H2,1-2H3/p+1/t10-,11?,12+,21?/m1/s1 |
| InChIKey | QZIZFHIZXVRHIF-IDECUTJNSA-O |
| XLogP | 3.15 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|