C11H21N2O3S+ — CID 57001837
(2R)-1-[4-amino-2-(sulfanylmethyl)butanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57001837) has the molecular formula C11H21N2O3S+ and a molecular weight of 261.37 g/mol. Its IUPAC name is (2R)-1-[4-amino-2-(sulfanylmethyl)butanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[4-amino-2-(sulfanylmethyl)butanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57001837 |
| Molecular Formula | C11H21N2O3S+ |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (2R)-1-[4-amino-2-(sulfanylmethyl)butanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(CS)CCN |
| InChI | InChI=1S/C11H20N2O3S/c1-8-3-2-6-13(8,11(15)16)10(14)9(7-17)4-5-12/h8-9H,2-7,12H2,1H3,(H-,15,16,17)/p+1/t8-,9?,13?/m1/s1 |
| InChIKey | VDBOHJNTNGFDFO-BGQFSCJGSA-O |
| XLogP | 1.08 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|