C10H18NO3S+ — CID 54267962
(2R)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 54267962) has the molecular formula C10H18NO3S+ and a molecular weight of 232.32 g/mol. Its IUPAC name is (2R)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 54267962 |
| Molecular Formula | C10H18NO3S+ |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (2R)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(CS)C(=O)[N+]1(C(=O)O)CCC[C@H]1C |
| InChI | InChI=1S/C10H17NO3S/c1-7(6-15)9(12)11(10(13)14)5-3-4-8(11)2/h7-8H,3-6H2,1-2H3,(H-,13,14,15)/p+1/t7?,8-,11?/m1/s1 |
| InChIKey | UGMBUQXTGFKWGV-JKDSDDBFSA-O |
| XLogP | 1.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|