C10H17FNO3S+ — CID 57118030
(1R,2R,4R)-4-fluoro-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57118030) has the molecular formula C10H17FNO3S+ and a molecular weight of 250.31 g/mol. Its IUPAC name is (1R,2R,4R)-4-fluoro-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-fluoro-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57118030 |
| Molecular Formula | C10H17FNO3S+ |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (1R,2R,4R)-4-fluoro-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(CS)C(=O)[N@@+]1(C(=O)O)C[C@H](F)C[C@H]1C |
| InChI | InChI=1S/C10H16FNO3S/c1-6(5-16)9(13)12(10(14)15)4-8(11)3-7(12)2/h6-8H,3-5H2,1-2H3,(H-,14,15,16)/p+1/t6?,7-,8-,12-/m1/s1 |
| InChIKey | KWMDGHFBLQZBSM-FXGWEAOSSA-O |
| XLogP | 1.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|