C10H15F3NO3S+ — CID 57261499
(2R)-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57261499) has the molecular formula C10H15F3NO3S+ and a molecular weight of 286.30 g/mol. Its IUPAC name is (2R)-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57261499 |
| Molecular Formula | C10H15F3NO3S+ |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2R)-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(CS)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3S/c1-6-3-2-4-14(6,9(16)17)8(15)7(5-18)10(11,12)13/h6-7H,2-5H2,1H3,(H-,16,17,18)/p+1/t6-,7?,14?/m1/s1 |
| InChIKey | KGSWJBPGJGAEMM-GALKBYNHSA-O |
| XLogP | 2.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|