C10H14F4NO3S+ — CID 57103340
(1R,2R,4R)-4-fluoro-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57103340) has the molecular formula C10H14F4NO3S+ and a molecular weight of 304.29 g/mol. Its IUPAC name is (1R,2R,4R)-4-fluoro-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-fluoro-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57103340 |
| Molecular Formula | C10H14F4NO3S+ |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (1R,2R,4R)-4-fluoro-2-methyl-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1C[C@@H](F)C[N@+]1(C(=O)O)C(=O)C(CS)C(F)(F)F |
| InChI | InChI=1S/C10H13F4NO3S/c1-5-2-6(11)3-15(5,9(17)18)8(16)7(4-19)10(12,13)14/h5-7H,2-4H2,1H3,(H-,17,18,19)/p+1/t5-,6-,7?,15-/m1/s1 |
| InChIKey | DFLGUFSICPUULD-UKMQQJOMSA-O |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|