C9H13F3NO3S+ — CID 57095693
(2R)-2-methyl-1-(3,3,3-trifluoro-2-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57095693) has the molecular formula C9H13F3NO3S+ and a molecular weight of 272.27 g/mol. Its IUPAC name is (2R)-2-methyl-1-(3,3,3-trifluoro-2-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-2-methyl-1-(3,3,3-trifluoro-2-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57095693 |
| Molecular Formula | C9H13F3NO3S+ |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2R)-2-methyl-1-(3,3,3-trifluoro-2-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)C(S)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3S/c1-5-3-2-4-13(5,8(15)16)7(14)6(17)9(10,11)12/h5-6H,2-4H2,1H3,(H-,15,16,17)/p+1/t5-,6?,13?/m1/s1 |
| InChIKey | TVWICABXUAYRNU-VNFFJNKYSA-O |
| XLogP | 2.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|