C12H17F3NO4S+ — CID 57025138
(2R)-1-(3-acetylsulfanyl-4,4,4-trifluorobutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57025138) has the molecular formula C12H17F3NO4S+ and a molecular weight of 328.33 g/mol. Its IUPAC name is (2R)-1-(3-acetylsulfanyl-4,4,4-trifluorobutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-(3-acetylsulfanyl-4,4,4-trifluorobutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57025138 |
| Molecular Formula | C12H17F3NO4S+ |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (2R)-1-(3-acetylsulfanyl-4,4,4-trifluorobutanoyl)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(=O)SC(CC(=O)[N+]1(C(=O)O)CCC[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO4S/c1-7-4-3-5-16(7,11(19)20)10(18)6-9(12(13,14)15)21-8(2)17/h7,9H,3-6H2,1-2H3/p+1/t7-,9?,16?/m1/s1 |
| InChIKey | OWOFGDCBDDJITR-ZELGWNNZSA-O |
| XLogP | 2.79 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|