C16H25F3NO4S+ — CID 57155538
tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57155538) has the molecular formula C16H25F3NO4S+ and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57155538 |
| Molecular Formula | C16H25F3NO4S+ |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | tert-butyl (2R)-1-[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(=O)SCC(C(=O)[N+]1(C(=O)OC(C)(C)C)CCC[C@H]1C)C(F)(F)F |
| InChI | InChI=1S/C16H25F3NO4S/c1-10-7-6-8-20(10,14(23)24-15(3,4)5)13(22)12(16(17,18)19)9-25-11(2)21/h10,12H,6-9H2,1-5H3/q+1/t10-,12?,20?/m1/s1 |
| InChIKey | OGYJDHVHGFJCAP-BLZGGWKYSA-N |
| XLogP | 3.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|