C11H20NO4+ — CID 22882822
(2S)-1-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 22882822) has the molecular formula C11H20NO4+ and a molecular weight of 230.28 g/mol. Its IUPAC name is (2S)-1-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 22882822 |
| Molecular Formula | C11H20NO4+ |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2S)-1-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)[N+]1(C)CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12(4)7-5-6-8(12)9(13)14/h8H,5-7H2,1-4H3/p+1/t8-,12?/m0/s1 |
| InChIKey | HKTUCCCMPUZFBI-KBPLZSHQSA-O |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|