C12H24INO3 — CID 146629252
tert-butyl [(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methyl carbonate iodide (PubChem CID 146629252) has the molecular formula C12H24INO3 and a molecular weight of 357.23 g/mol. Its IUPAC name is tert-butyl [(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methyl carbonate iodide.
| Compound Name | tert-butyl [(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methyl carbonate iodide |
|---|---|
| PubChem CID | 146629252 |
| Molecular Formula | C12H24INO3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | tert-butyl [(2S)-1,1-dimethylpyrrolidin-1-ium-2-yl]methyl carbonate iodide |
| SMILES | CC(C)(C)OC(=O)OC[C@@H]1CCC[N+]1(C)C.[I-] |
| InChI | InChI=1S/C12H24NO3.HI/c1-12(2,3)16-11(14)15-9-10-7-6-8-13(10,4)5;/h10H,6-9H2,1-5H3;1H/q+1;/p-1/t10-;/m0./s1 |
| InChIKey | UNPDLJKVDOQTTP-PPHPATTJSA-M |
| XLogP | -0.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|