C9H19N2O2+ — CID 123639679
tert-butyl 3-amino-1-methylazetidin-1-ium-1-carboxylate (PubChem CID 123639679) has the molecular formula C9H19N2O2+ and a molecular weight of 187.26 g/mol. Its IUPAC name is tert-butyl 3-amino-1-methylazetidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 3-amino-1-methylazetidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 123639679 |
| Molecular Formula | C9H19N2O2+ |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | tert-butyl 3-amino-1-methylazetidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C)CC(N)C1 |
| InChI | InChI=1S/C9H19N2O2/c1-9(2,3)13-8(12)11(4)5-7(10)6-11/h7H,5-6,10H2,1-4H3/q+1 |
| InChIKey | CPWPRGLJRVBFCI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|