C19H37N2O2+ — CID 112544663
tert-butyl 3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-carboxylate (PubChem CID 112544663) has the molecular formula C19H37N2O2+ and a molecular weight of 325.52 g/mol. Its IUPAC name is tert-butyl 3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 112544663 |
| Molecular Formula | C19H37N2O2+ |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | tert-butyl 3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-carboxylate |
| SMILES | CCCCC1CC(N)C[N+](C(=O)OC(C)(C)C)(C2CC(C)C2)C1 |
| InChI | InChI=1S/C19H37N2O2/c1-6-7-8-15-11-16(20)13-21(12-15,17-9-14(2)10-17)18(22)23-19(3,4)5/h14-17H,6-13,20H2,1-5H3/q+1 |
| InChIKey | YZACWNTVQHYVMX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|