C19H37N2O+ — CID 112542399
1-[3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 112542399) has the molecular formula C19H37N2O+ and a molecular weight of 309.52 g/mol. Its IUPAC name is 1-[3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 112542399 |
| Molecular Formula | C19H37N2O+ |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.29 |
| IUPAC Name | 1-[3-amino-5-butyl-1-(3-methylcyclobutyl)piperidin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CCCCC1CC(N)C[N+](C(=O)C(C)(C)C)(C2CC(C)C2)C1 |
| InChI | InChI=1S/C19H37N2O/c1-6-7-8-15-11-16(20)13-21(12-15,17-9-14(2)10-17)18(22)19(3,4)5/h14-17H,6-13,20H2,1-5H3/q+1 |
| InChIKey | SPJAYXUTIKSKQP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|