C16H31F2N2+ — CID 112541362
5-butyl-1-(2,2-difluoroethyl)-1-(3-methylcyclobutyl)piperidin-1-ium-3-amine (PubChem CID 112541362) has the molecular formula C16H31F2N2+ and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-butyl-1-(2,2-difluoroethyl)-1-(3-methylcyclobutyl)piperidin-1-ium-3-amine.
| Compound Name | 5-butyl-1-(2,2-difluoroethyl)-1-(3-methylcyclobutyl)piperidin-1-ium-3-amine |
|---|---|
| PubChem CID | 112541362 |
| Molecular Formula | C16H31F2N2+ |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 5-butyl-1-(2,2-difluoroethyl)-1-(3-methylcyclobutyl)piperidin-1-ium-3-amine |
| SMILES | CCCCC1CC(N)C[N+](CC(F)F)(C2CC(C)C2)C1 |
| InChI | InChI=1S/C16H31F2N2/c1-3-4-5-13-8-14(19)10-20(9-13,11-16(17)18)15-6-12(2)7-15/h12-16H,3-11,19H2,1-2H3/q+1 |
| InChIKey | TWAHVPAPVLPIDE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|