C11H16NO3+ — CID 87592180
tert-butyl (1R,4S)-5-oxo-1-azoniabicyclo[2.2.1]hept-2-ene-1-carboxylate (PubChem CID 87592180) has the molecular formula C11H16NO3+ and a molecular weight of 210.25 g/mol. Its IUPAC name is tert-butyl (1R,4S)-5-oxo-1-azoniabicyclo[2.2.1]hept-2-ene-1-carboxylate.
| Compound Name | tert-butyl (1R,4S)-5-oxo-1-azoniabicyclo[2.2.1]hept-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 87592180 |
| Molecular Formula | C11H16NO3+ |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | tert-butyl (1R,4S)-5-oxo-1-azoniabicyclo[2.2.1]hept-2-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N@+]12C=C[C@@H](C1)C(=O)C2 |
| InChI | InChI=1S/C11H16NO3/c1-11(2,3)15-10(14)12-5-4-8(6-12)9(13)7-12/h4-5,8H,6-7H2,1-3H3/q+1/t8-,12+/m0/s1 |
| InChIKey | ONLFRWGKCRAEFG-QPUJVOFHSA-N |
| XLogP | 1.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|