C15H20O4 — CID 101281107
tert-butyl (1S,3S,5R,7R)-4,8-dioxoadamantane-2-carboxylate (PubChem CID 101281107) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is tert-butyl (1S,3S,5R,7R)-4,8-dioxoadamantane-2-carboxylate.
| Compound Name | tert-butyl (1S,3S,5R,7R)-4,8-dioxoadamantane-2-carboxylate |
|---|---|
| PubChem CID | 101281107 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | tert-butyl (1S,3S,5R,7R)-4,8-dioxoadamantane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1[C@@H]2C[C@H]3C[C@H](C[C@@H]1C3=O)C2=O |
| InChI | InChI=1S/C15H20O4/c1-15(2,3)19-14(18)11-9-5-7-4-8(13(9)17)6-10(11)12(7)16/h7-11H,4-6H2,1-3H3/t7-,8-,9+,10+/m1/s1 |
| InChIKey | FNHWXKMBBMVCFE-IMSYWVGJSA-N |
| XLogP | 1.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |