C15H26NO4+ — CID 57262911
(4aR,8aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-carboxylic acid (PubChem CID 57262911) has the molecular formula C15H26NO4+ and a molecular weight of 284.38 g/mol. Its IUPAC name is (4aR,8aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-carboxylic acid.
| Compound Name | (4aR,8aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 57262911 |
| Molecular Formula | C15H26NO4+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (4aR,8aR)-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(=O)O)CC[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C15H25NO4/c1-15(2,3)20-14(19)16(13(17)18)9-8-11-6-4-5-7-12(11)10-16/h11-12H,4-10H2,1-3H3/p+1/t11-,12+,16?/m1/s1 |
| InChIKey | AQYOPYWPJICPRJ-WWMUWCCSSA-O |
| XLogP | 3.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|