C23H25NO3 — CID 11199289
2-[[(2S)-1-methyl-1-prop-2-ynylpyrrolidin-1-ium-2-yl]methoxy]-2-oxo-1,1-diphenylethanolate (PubChem CID 11199289) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[(2S)-1-methyl-1-prop-2-ynylpyrrolidin-1-ium-2-yl]methoxy]-2-oxo-1,1-diphenylethanolate.
| Compound Name | 2-[[(2S)-1-methyl-1-prop-2-ynylpyrrolidin-1-ium-2-yl]methoxy]-2-oxo-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11199289 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[[(2S)-1-methyl-1-prop-2-ynylpyrrolidin-1-ium-2-yl]methoxy]-2-oxo-1,1-diphenylethanolate |
| SMILES | C#CC[N+]1(C)CCC[C@H]1COC(=O)C([O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO3/c1-3-16-24(2)17-10-15-21(24)18-27-22(25)23(26,19-11-6-4-7-12-19)20-13-8-5-9-14-20/h1,4-9,11-14,21H,10,15-18H2,2H3/t21-,24?/m0/s1 |
| InChIKey | FLICTOHGRJMYRN-XEGCMXMBSA-N |
| XLogP | 2.08 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|