C28H35NO3 — CID 11339490
2-[[(3S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-3-yl]methoxy]-2-oxo-1,1-diphenylethanolate (PubChem CID 11339490) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[[(3S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-3-yl]methoxy]-2-oxo-1,1-diphenylethanolate.
| Compound Name | 2-[[(3S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-3-yl]methoxy]-2-oxo-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11339490 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-[[(3S)-1-methyl-1-oct-2-ynylpyrrolidin-1-ium-3-yl]methoxy]-2-oxo-1,1-diphenylethanolate |
| SMILES | CCCCCC#CC[N+]1(C)CC[C@H](COC(=O)C([O-])(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H35NO3/c1-3-4-5-6-7-14-20-29(2)21-19-24(22-29)23-32-27(30)28(31,25-15-10-8-11-16-25)26-17-12-9-13-18-26/h8-13,15-18,24H,3-6,19-23H2,1-2H3/t24-,29?/m0/s1 |
| InChIKey | VSMFMLSJOJCTSB-CTLOQAHHSA-N |
| XLogP | 3.88 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|